Difference between revisions of "PARAOXON"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** xgyimtfotbmpfp-kqy...") |
(Created page with "Category:metabolite == Metabolite PARAOXON == * common-name: ** paraoxon * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o * inchi-key: ** wymsbxtxohuigt-uhfffaoysa-n...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PARAOXON == |
* common-name: | * common-name: | ||
| − | ** | + | ** paraoxon |
* smiles: | * smiles: | ||
| − | ** | + | ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wymsbxtxohuigt-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 275.197 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8746]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=paraoxon}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wymsbxtxohuigt-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=275.197}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite PARAOXON
- common-name:
- paraoxon
- smiles:
- ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
- inchi-key:
- wymsbxtxohuigt-uhfffaoysa-n
- molecular-weight:
- 275.197
