Difference between revisions of "PARAOXON"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.180-RXN 2.3.1.180-RXN] == * direction: ** left-to-right * common-name: ** β-ketoacyl-acp...")
 
(Created page with "Category:metabolite == Metabolite PARAOXON == * common-name: ** paraoxon * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o * inchi-key: ** wymsbxtxohuigt-uhfffaoysa-n...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.180-RXN 2.3.1.180-RXN] ==
+
== Metabolite PARAOXON ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** β-ketoacyl-acp synthase
+
** paraoxon
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.180 ec-2.3.1.180]
+
** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ACETYL-COA]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Acetoacetyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c]
+
** wymsbxtxohuigt-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ15983]]
+
** 275.197
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8746]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-4381]], fatty acid biosynthesis initiation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
{{#set: common-name=paraoxon}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=wymsbxtxohuigt-uhfffaoysa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=275.197}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12083 12083]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=β-ketoacyl-acp synthase}}
 
−
{{#set: ec-number=ec-2.3.1.180}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite PARAOXON

  • common-name:
    • paraoxon
  • smiles:
    • ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
  • inchi-key:
    • wymsbxtxohuigt-uhfffaoysa-n
  • molecular-weight:
    • 275.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PARAOXON&oldid=139697"