Difference between revisions of "PARAOXON"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE-5-DEHYDROGENASE-RXN GLUCONATE-5-DEHYDROGENASE-RXN] == * direction: ** left-to-right * com...")
(Created page with "Category:metabolite == Metabolite PAPS == * common-name: ** 3'-phosphoadenylyl-sulfate * smiles: ** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE-5-DEHYDROGENASE-RXN GLUCONATE-5-DEHYDROGENASE-RXN] ==
+
== Metabolite PAPS ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 5-keto-d-gluconate 5-reductase
+
** 3'-phosphoadenylyl-sulfate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.69 ec-1.1.1.69]
+
** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[5-DEHYDROGLUCONATE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[GLUCONATE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c]
+
** gacdqmdrprgctn-kqynxxcusa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04229]]
+
** 503.23
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
== Pathway(s)  ==
+
* [[1.8.4.8-RXN]]
−
* [[IDNCAT-PWY]], L-idonate degradation: [http://metacyc.org/META/NEW-IMAGE?object=IDNCAT-PWY IDNCAT-PWY]
+
* [[2.8.2.23-RXN]]
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[2.8.2.29-RXN]]
−
== Reconstruction information  ==
+
* [[2.8.2.30-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ADENYLYLSULFKIN-RXN]]
−
== External links  ==
+
* [[ARYL-SULFOTRANSFERASE-RXN]]
−
* RHEA:
+
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23938 23938]
+
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
−
* LIGAND-RXN:
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01738 R01738]
+
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R01740 R01740]
+
* [[PAPSPAPthr]]
−
* UNIPROT:
+
* [[R163-RXN]]
−
** [http://www.uniprot.org/uniprot/P50199 P50199]
+
* [[RXN-10614]]
−
{{#set: direction=left-to-right}}
+
* [[RXN-10615]]
−
{{#set: common-name=5-keto-d-gluconate 5-reductase}}
+
* [[RXN-10777]]
−
{{#set: ec-number=ec-1.1.1.69}}
+
* [[RXN-10782]]
−
{{#set: nb gene associated=1}}
+
* [[RXN-11058]]
−
{{#set: nb pathway associated=1}}
+
* [[RXN-11059]]
−
{{#set: reconstruction category=annotation}}
+
* [[RXN-11555]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[RXN-15587]]
−
{{#set: reconstruction comment=n.a}}
+
* [[RXN-15588]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[RXN-15589]]
 +
* [[RXN-17203]]
 +
* [[RXN-18301]]
 +
* [[RXN-18303]]
 +
* [[RXN-701]]
 +
* [[RXN-7953]]
 +
* [[RXN-7954]]
 +
* [[RXN6666-9]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[1.8.4.8-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 +
* [[PAPSPAPthr]]
 +
* [[R163-RXN]]
 +
* [[RXN-15587]]
 +
* [[RXN-15588]]
 +
* [[RXN-15589]]
 +
* [[RXN-17203]]
 +
* [[RXN-701]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3'-phosphoadenylyl-sulfate}}
 +
{{#set: inchi-key=inchikey=gacdqmdrprgctn-kqynxxcusa-j}}
 +
{{#set: molecular-weight=503.23}}

Revision as of 20:37, 18 December 2020

Metabolite PAPS

  • common-name:
    • 3'-phosphoadenylyl-sulfate
  • smiles:
    • c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23)))
  • inchi-key:
    • gacdqmdrprgctn-kqynxxcusa-j
  • molecular-weight:
    • 503.23

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PARAOXON&oldid=48513"