Difference between revisions of "PARATHION"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07200 == * transcription-direction: ** negative * right-end-position: ** 627237 * left-end-position: ** 610107 * centisome-position: ** 41.757374...")
(Created page with "Category:metabolite == Metabolite PARATHION == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s * inchi-key: ** lccncvornkjirz-uhfffaoysa...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ07200 ==
+
== Metabolite PARATHION ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** parathion
−
* right-end-position:
+
* smiles:
−
** 627237
+
** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
−
* left-end-position:
+
* inchi-key:
−
** 610107
+
** lccncvornkjirz-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 41.757374   
+
** 291.258
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GDPPYPHOSKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=parathion}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=lccncvornkjirz-uhfffaoysa-n}}
−
* [[GTPPYPHOSKIN-RXN]]
+
{{#set: molecular-weight=291.258}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PPGPPSYN-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-6427]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PPGPPMET-PWY]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=627237}}
 
−
{{#set: left-end-position=610107}}
 
−
{{#set: centisome-position=41.757374    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite PARATHION

  • common-name:
    • parathion
  • smiles:
    • ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
  • inchi-key:
    • lccncvornkjirz-uhfffaoysa-n
  • molecular-weight:
    • 291.258

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PARATHION&oldid=137743"