Difference between revisions of "PARATHION"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8541 == * common-name: ** a [protein]-n4-(n-acetyl-β-d-glucosaminyl)-l-asparagine == Reaction(s) known to consume the compound =...")
(Created page with "Category:metabolite == Metabolite PARATHION == * common-name: ** parathion * smiles: ** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s * inchi-key: ** lccncvornkjirz-uhfffaoysa...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8541 ==
+
== Metabolite PARATHION ==
 
* common-name:
 
* common-name:
** a [protein]-n4-(n-acetyl-β-d-glucosaminyl)-l-asparagine
+
** parathion
 +
* smiles:
 +
** ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
 +
* inchi-key:
 +
** lccncvornkjirz-uhfffaoysa-n
 +
* molecular-weight:
 +
** 291.258
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.94-RXN]]
+
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
* [[3.5.1.52-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.94-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-n4-(n-acetyl-β-d-glucosaminyl)-l-asparagine}}
+
{{#set: common-name=parathion}}
 +
{{#set: inchi-key=inchikey=lccncvornkjirz-uhfffaoysa-n}}
 +
{{#set: molecular-weight=291.258}}

Latest revision as of 11:13, 18 March 2021

Metabolite PARATHION

  • common-name:
    • parathion
  • smiles:
    • ccop(oc1(c=cc(=cc=1)[n+](=o)[o-]))(occ)=s
  • inchi-key:
    • lccncvornkjirz-uhfffaoysa-n
  • molecular-weight:
    • 291.258

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality