Difference between revisions of "PARATHION"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13578 == * common-name: ** aminomethylpyrimidine * smiles: ** cc1(=nc(=c(c[n+])c=n1)n) * inchi-key: ** ozohtvfcskfmll-uhfffaoysa-o *...") |
(Created page with "Category:metabolite == Metabolite CPD-9955 == * common-name: ** ubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-9955 == |
* common-name: | * common-name: | ||
| − | ** | + | ** ubiquinol-7 |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pfiusppkanbdhq-rjyqsxaysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 661.019 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9229]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ubiquinol-7}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pfiusppkanbdhq-rjyqsxaysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=661.019}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-9955
- common-name:
- ubiquinol-7
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
- inchi-key:
- pfiusppkanbdhq-rjyqsxaysa-n
- molecular-weight:
- 661.019
