Difference between revisions of "PELARGONIDIN-3-GLUCOSIDE-CMPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-ALKYL-GLYCERONE-3-PHOSPHATE == * common-name: ** a 1-alkyl-glycerone 3-phosphate == Reaction(s) known to consume the compound == * RX...") |
(Created page with "Category:metabolite == Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD == * common-name: ** pelargonidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD == |
* common-name: | * common-name: | ||
| − | ** | + | ** pelargonidin-3-o-β-d-glucoside |
| + | * smiles: | ||
| + | ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-]))) | ||
| + | * inchi-key: | ||
| + | ** abvcubuixwjyse-gqupqbgvsa-m | ||
| + | * molecular-weight: | ||
| + | ** 431.375 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7828]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pelargonidin-3-o-β-d-glucoside}} |
| + | {{#set: inchi-key=inchikey=abvcubuixwjyse-gqupqbgvsa-m}} | ||
| + | {{#set: molecular-weight=431.375}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite PELARGONIDIN-3-GLUCOSIDE-CMPD
- common-name:
- pelargonidin-3-o-β-d-glucoside
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)oc3(=cc4(=c([o+]=c(c2(=cc=c(o)c=c2))3)c=c(c=c([o-])4)[o-])))
- inchi-key:
- abvcubuixwjyse-gqupqbgvsa-m
- molecular-weight:
- 431.375
