Difference between revisions of "PEPTIDOGLYCANSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * common-name: ** taxiphyllin * smiles: ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apocytochromes-c Apocytochromes-c] == * common-name: ** an apo-[c-type cytochrome] == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apocytochromes-c Apocytochromes-c] ==
 
* common-name:
 
* common-name:
** taxiphyllin
+
** an apo-[c-type cytochrome]
* smiles:
 
** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n)
 
* inchi-key:
 
** nvltyojhpbmilu-gmdxdwkasa-n
 
* molecular-weight:
 
** 311.291
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13600]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=taxiphyllin}}
+
{{#set: common-name=an apo-[c-type cytochrome]}}
{{#set: inchi-key=inchikey=nvltyojhpbmilu-gmdxdwkasa-n}}
 
{{#set: molecular-weight=311.291}}
 

Revision as of 14:19, 26 August 2019

Metabolite Apocytochromes-c

  • common-name:
    • an apo-[c-type cytochrome]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[c-type cytochrome" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.