Difference between revisions of "PHE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14405 == * common-name: ** 3r-hydroxy-dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c...") |
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * mole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-phenylalanine |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** colnvldhvkwlrt-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 165.191 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.6.1.64-RXN]] |
| + | * [[PHEAMINOTRANS-RXN]] | ||
| + | * [[PHENYLALANINE--TRNA-LIGASE-RXN]] | ||
| + | * [[RXN-10814]] | ||
| + | * [[RXN-17130]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.6.1.64-RXN]] |
| + | * [[PHEAMINOTRANS-RXN]] | ||
| + | * [[RXN-10814]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-phenylalanine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=165.191}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite PHE
- common-name:
- l-phenylalanine
- smiles:
- c([o-])(=o)c([n+])cc1(c=cc=cc=1)
- inchi-key:
- colnvldhvkwlrt-qmmmgpobsa-n
- molecular-weight:
- 165.191
