Difference between revisions of "PHE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == * common-name: ** l-α-amino-ε-keto-pimelate * smiles: ** c([o-])(=o)c(cccc(c([o-])=o...") |
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * mole...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHE == |
* common-name: | * common-name: | ||
− | ** l- | + | ** l-phenylalanine |
* smiles: | * smiles: | ||
− | ** c([o-])(=o) | + | ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** colnvldhvkwlrt-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 165.191 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.6.1.64-RXN]] |
+ | * [[PHEAMINOTRANS-RXN]] | ||
+ | * [[PHENYLALANINE--TRNA-LIGASE-RXN]] | ||
+ | * [[RXN-10814]] | ||
+ | * [[RXN-17130]] | ||
+ | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.6.1.64-RXN]] |
+ | * [[PHEAMINOTRANS-RXN]] | ||
+ | * [[RXN-10814]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=l- | + | {{#set: common-name=l-phenylalanine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=165.191}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite PHE
- common-name:
- l-phenylalanine
- smiles:
- c([o-])(=o)c([n+])cc1(c=cc=cc=1)
- inchi-key:
- colnvldhvkwlrt-qmmmgpobsa-n
- molecular-weight:
- 165.191