Difference between revisions of "PHE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19377 == * transcription-direction: ** negative * right-end-position: ** 128998 * left-end-position: ** 77995 * centisome-position: ** 34.24964...")
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * mole...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19377 ==
+
== Metabolite PHE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** l-phenylalanine
−
* right-end-position:
+
* smiles:
−
** 128998
+
** c([o-])(=o)c([n+])cc1(c=cc=cc=1)
−
* left-end-position:
+
* inchi-key:
−
** 77995
+
** colnvldhvkwlrt-qmmmgpobsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 34.24964   
+
** 165.191
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.6.1.64-RXN]]
−
== Reaction(s) associated ==
+
* [[PHEAMINOTRANS-RXN]]
−
* [[ATPASE-RXN]]
+
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-10814]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-17130]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[biomass_rxn]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2.6.1.64-RXN]]
−
* [[RXN-12195]]
+
* [[PHEAMINOTRANS-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-10814]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-12196]]
+
{{#set: common-name=l-phenylalanine}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=165.191}}
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=128998}}
 
−
{{#set: left-end-position=77995}}
 
−
{{#set: centisome-position=34.24964    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite PHE

  • common-name:
    • l-phenylalanine
  • smiles:
    • c([o-])(=o)c([n+])cc1(c=cc=cc=1)
  • inchi-key:
    • colnvldhvkwlrt-qmmmgpobsa-n
  • molecular-weight:
    • 165.191

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PHE&oldid=138264"