Difference between revisions of "PHENYL-PYRUVATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.3.4.9-RXN 6.3.4.9-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org...") |
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite PHENYL-PYRUVATE == |
− | * | + | * common-name: |
− | ** | + | ** keto-phenylpyruvate |
− | * | + | * smiles: |
− | ** [ | + | ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) |
− | == | + | * inchi-key: |
− | * | + | ** btnmpgbkdvtsjy-uhfffaoysa-m |
− | == | + | * molecular-weight: |
− | * | + | ** 163.152 |
− | * | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[2.6.1.64-RXN]] |
− | * | + | * [[PHEAMINOTRANS-RXN]] |
− | * | + | * [[PREPHENATEDEHYDRAT-RXN]] |
− | * | + | * [[RXN-10814]] |
− | + | * [[RXN-10815]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[2.6.1.64-RXN]] |
− | * | + | * [[PHEAMINOTRANS-RXN]] |
− | * | + | * [[PPDH]] |
− | * | + | * [[PREPHENATEDEHYDRAT-RXN]] |
− | == | + | * [[RXN-10814]] |
− | + | * [[RXN-17130]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=keto-phenylpyruvate}} | |
− | + | {{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}} | |
− | + | {{#set: molecular-weight=163.152}} | |
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite PHENYL-PYRUVATE
- common-name:
- keto-phenylpyruvate
- smiles:
- c([o-])(=o)c(=o)cc1(=cc=cc=c1)
- inchi-key:
- btnmpgbkdvtsjy-uhfffaoysa-m
- molecular-weight:
- 163.152