Difference between revisions of "PHENYL-PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-550 RXN66-550] == * direction: ** left-to-right * common-name: ** electron-transferring-flavo...")
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-550 RXN66-550] ==
+
== Metabolite PHENYL-PYRUVATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** electron-transferring-flavoprotein dehydrogenase
+
** keto-phenylpyruvate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.5.5.1 ec-1.5.5.1]
+
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ETF-Reduced]][c] '''+''' 1 [[Ubiquinones]][c] '''=>''' 1 [[ETF-Oxidized]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Ubiquinols]][c]
+
** btnmpgbkdvtsjy-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ02798]]
+
** 163.152
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.6.1.64-RXN]]
−
** Category: [[orthology]]
+
* [[PHEAMINOTRANS-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PREPHENATEDEHYDRAT-RXN]]
−
* Gene: [[SJ04490]]
+
* [[RXN-10814]]
−
** Category: [[annotation]]
+
* [[RXN-10815]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[2.6.1.64-RXN]]
−
== Reconstruction information  ==
+
* [[PHEAMINOTRANS-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[PPDH]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PREPHENATEDEHYDRAT-RXN]]
−
== External links  ==
+
* [[RXN-10814]]
−
* LIGAND-RXN:
+
* [[RXN-17130]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R04433 R04433]
+
== Reaction(s) of unknown directionality ==
−
* RHEA:
+
{{#set: common-name=keto-phenylpyruvate}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24053 24053]
+
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}
−
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=163.152}}
−
{{#set: common-name=electron-transferring-flavoprotein dehydrogenase}}
 
−
{{#set: ec-number=ec-1.5.5.1}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite PHENYL-PYRUVATE

  • common-name:
    • keto-phenylpyruvate
  • smiles:
    • c([o-])(=o)c(=o)cc1(=cc=cc=c1)
  • inchi-key:
    • btnmpgbkdvtsjy-uhfffaoysa-m
  • molecular-weight:
    • 163.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PHENYL-PYRUVATE&oldid=139471"