Difference between revisions of "PHENYLACETALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD6666-1 == * common-name: ** oleamide * smiles: ** ccccccccc=ccccccccc(n)=o * inchi-key: ** fatbgeamymyzaf-ktkrtigzsa-n * molecular-wei...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ == * common-name: ** 3-demethylubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-demethylubiquinol-8 |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qurlimhpcrkmjp-wdxiliiosa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 715.11 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DHHB-METHYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-demethylubiquinol-8}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qurlimhpcrkmjp-wdxiliiosa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=715.11}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ
- common-name:
- 3-demethylubiquinol-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
- inchi-key:
- qurlimhpcrkmjp-wdxiliiosa-n
- molecular-weight:
- 715.11
