Difference between revisions of "PHENYLACETALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11555 == * common-name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) * inchi-key: ** wfnzgu...") |
(Created page with "Category:metabolite == Metabolite CPD6666-1 == * common-name: ** oleamide * smiles: ** ccccccccc=ccccccccc(n)=o * inchi-key: ** fatbgeamymyzaf-ktkrtigzsa-n * molecular-wei...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD6666-1 == |
* common-name: | * common-name: | ||
| − | ** | + | ** oleamide |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccc(n)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fatbgeamymyzaf-ktkrtigzsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 281.481 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10756]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10756]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=oleamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fatbgeamymyzaf-ktkrtigzsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=281.481}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD6666-1
- common-name:
- oleamide
- smiles:
- ccccccccc=ccccccccc(n)=o
- inchi-key:
- fatbgeamymyzaf-ktkrtigzsa-n
- molecular-weight:
- 281.481
