Difference between revisions of "PHESYN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CYS HOMO-CYS] == * common-name: ** l-homocysteine * smiles: ** c(c(ccs)[n+])(=o)[o-] * inc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == * common-name: ** violaxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == |
* common-name: | * common-name: | ||
| − | ** | + | ** violaxanthin |
* smiles: | * smiles: | ||
| − | ** c(c( | + | ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** szcbxwmuopqsox-wvjdlnglsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 600.88 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13185]] |
| − | + | * [[RXN-7984]] | |
| − | + | * [[RXN1F-155]] | |
| − | |||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13185]] |
| − | + | * [[RXN-7979]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=violaxanthin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=szcbxwmuopqsox-wvjdlnglsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=600.88}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD1F-133
- common-name:
- violaxanthin
- smiles:
- cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
- inchi-key:
- szcbxwmuopqsox-wvjdlnglsa-n
- molecular-weight:
- 600.88
