Difference between revisions of "PHOSLIPSYN2-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAPhe-wybutosine tRNAPhe-wybutosine] == * common-name: ** wybutosine37 in trnaphe == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAPhe-wybutosine tRNAPhe-wybutosine] ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa
+
** wybutosine37 in trnaphe
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
** jziqdjlbfktbak-llhoyasasa-j
 
* molecular-weight:
 
** 1039.92
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10696]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14520]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-coa}}
+
{{#set: common-name=wybutosine37 in trnaphe}}
{{#set: inchi-key=inchikey=jziqdjlbfktbak-llhoyasasa-j}}
 
{{#set: molecular-weight=1039.92}}
 

Revision as of 09:23, 27 August 2019

Metabolite tRNAPhe-wybutosine

  • common-name:
    • wybutosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality