Difference between revisions of "PHOSPHATIDYL-MYO-INOSITOL-45-BISPHOSPHA"

Revision as of 13:11, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite N6N6N6-TRIMETHYL-L-LYSINE ==
+== Metabolite L-HISTIDINOL-P ==
 * common-name:
-** n6,n6,n6-trimethyl-l-lysine
+** l-histidinol phosphate
 * smiles:
-** c[n+](ccccc(c([o-])=o)[n+])(c)c
+** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
 * inchi-key:
-** mxnrlfusfkvqsk-qmmmgpobsa-o
+** cwnderhthmwbsi-yfkpbyrvsa-m
 * molecular-weight:
-** 189.277
+** 220.144
 == Reaction(s) known to consume the compound ==
-* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
+* [[HISTAMINOTRANS-RXN]]
+* [[HISTIDPHOS-RXN]]
+* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
 == Reaction(s) known to produce the compound ==
+* [[HISTAMINOTRANS-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
+{{#set: common-name=l-histidinol phosphate}}
-{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
+{{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}}
-{{#set: molecular-weight=189.277}}
+{{#set: molecular-weight=220.144}}