Difference between revisions of "PHOSPHATIDYLCHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * smiles: ** coc1(=cc(c=cco)=cc=c(o)1) * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa...")
(Created page with "Category:metabolite == Metabolite PHOSPHATIDYLCHOLINE == * common-name: ** a phosphatidylcholine == Reaction(s) known to consume the compound == * 2.3.1.23-RXN * 2.7...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CONIFERYL-ALCOHOL ==
+
== Metabolite PHOSPHATIDYLCHOLINE ==
 
* common-name:
 
* common-name:
** coniferyl alcohol
+
** a phosphatidylcholine
* smiles:
 
** coc1(=cc(c=cco)=cc=c(o)1)
 
* inchi-key:
 
** jmfrwrfflbvwsi-nscuhmnnsa-n
 
* molecular-weight:
 
** 180.203
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17351]]
+
* [[2.3.1.23-RXN]]
* [[RXN-17352]]
+
* [[2.7.8.27-RXN]]
 +
* [[PHOSCHOL-RXN]]
 +
* [[PHOSPHOLIPASE-A1-RXN]]
 +
* [[PHOSPHOLIPASE-A2-RXN]]
 +
* [[PHOSPHOLIPASE-C-RXN]]
 +
* [[RXN-1501_METACYC18.5]]
 +
* [[RXN-15211]]
 +
* [[RXN-5781]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.3.1.23-RXN]]
 +
* [[2.7.8.27-RXN]]
 +
* [[RXN-5781]]
 +
* [[RXN4FS-2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coniferyl alcohol}}
+
{{#set: common-name=a phosphatidylcholine}}
{{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}}
 
{{#set: molecular-weight=180.203}}
 

Latest revision as of 11:18, 18 March 2021