Difference between revisions of "PHOSPHATIDYLCHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-LEU-tRNAs == * common-name: ** an l-leucyl-[trnaleu] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...") |
(Created page with "Category:metabolite == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == * common-name: ** 6-(hydroxymethyl)-7,8-dihydropterin * smiles: ** c(o)c2(=nc1(c(=o)nc(n)=nc=1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-(hydroxymethyl)-7,8-dihydropterin |
| + | * smiles: | ||
| + | ** c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2)) | ||
| + | * inchi-key: | ||
| + | ** cqqnnqtxugluev-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 195.18 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[H2NEOPTERINALDOL-RXN]] |
| + | * [[RXN-10857]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}} |
| + | {{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=195.18}} | ||
Revision as of 15:31, 5 January 2021
Contents
Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE
- common-name:
- 6-(hydroxymethyl)-7,8-dihydropterin
- smiles:
- c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2))
- inchi-key:
- cqqnnqtxugluev-uhfffaoysa-n
- molecular-weight:
- 195.18
