Difference between revisions of "PHOSPHO-ENOL-PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01337 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 2.7.10.1-RXN ** Catego...")
(Created page with "Category:metabolite == Metabolite PHOSPHO-ENOL-PYRUVATE == * common-name: ** phosphoenolpyruvate * smiles: ** c=c(op([o-])([o-])=o)c([o-])=o * inchi-key: ** dtbnbxwjwcwcik...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01337 ==
+
== Metabolite PHOSPHO-ENOL-PYRUVATE ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** phosphoenolpyruvate
== Reaction(s) associated ==
+
* smiles:
* [[2.7.10.1-RXN]]
+
** c=c(op([o-])([o-])=o)c([o-])=o
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** dtbnbxwjwcwcik-uhfffaoysa-k
* [[3.6.4.4-RXN]]
+
* molecular-weight:
** Category: [[orthology]]
+
** 165.019
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[2.5.1.19-RXN]]
** Category: [[orthology]]
+
* [[2PGADEHYDRAT-RXN]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[DAHPSYN-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[GTPOP]]
{{#set: nb reaction associated=3}}
+
* [[PEPCARBOX-RXN]]
 +
* [[PEPDEPHOS-RXN]]
 +
* [[PEPPIth]]
 +
* [[PPC]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
* [[RXN-14117]]
 +
* [[RXN-14192]]
 +
* [[RXN-14207]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[2.5.1.19-RXN]]
 +
* [[2PGADEHYDRAT-RXN]]
 +
* [[DAHPSYN-RXN]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PEPPIth]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=phosphoenolpyruvate}}
 +
{{#set: inchi-key=inchikey=dtbnbxwjwcwcik-uhfffaoysa-k}}
 +
{{#set: molecular-weight=165.019}}

Latest revision as of 11:12, 18 March 2021

Metabolite PHOSPHO-ENOL-PYRUVATE

  • common-name:
    • phosphoenolpyruvate
  • smiles:
    • c=c(op([o-])([o-])=o)c([o-])=o
  • inchi-key:
    • dtbnbxwjwcwcik-uhfffaoysa-k
  • molecular-weight:
    • 165.019

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality