Difference between revisions of "PHOSPHO-ENOL-PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07747 == * transcription-direction: ** positive * right-end-position: ** 199518 * left-end-position: ** 191199 * centisome-position: ** 21.60614...")
(Created page with "Category:metabolite == Metabolite PHOSPHO-ENOL-PYRUVATE == * common-name: ** phosphoenolpyruvate * smiles: ** c=c(op([o-])([o-])=o)c([o-])=o * inchi-key: ** dtbnbxwjwcwcik...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ07747 ==
+
== Metabolite PHOSPHO-ENOL-PYRUVATE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** phosphoenolpyruvate
−
* right-end-position:
+
* smiles:
−
** 199518
+
** c=c(op([o-])([o-])=o)c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 191199
+
** dtbnbxwjwcwcik-uhfffaoysa-k
−
* centisome-position:
+
* molecular-weight:
−
** 21.60614   
+
** 165.019
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.5.1.19-RXN]]
−
== Reaction(s) associated ==
+
* [[2PGADEHYDRAT-RXN]]
−
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[DAHPSYN-RXN]]
−
** Category: [[annotation]]
+
* [[GTPOP]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PEPCARBOX-RXN]]
−
* [[RXN-9614]]
+
* [[PEPDEPHOS-RXN]]
−
** Category: [[annotation]]
+
* [[PEPPIth]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PPC]]
−
* [[RXN0-1441]]
+
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-14117]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14192]]
−
{{#set: transcription-direction=positive}}
+
* [[RXN-14207]]
−
{{#set: right-end-position=199518}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: left-end-position=191199}}
+
* [[2.5.1.19-RXN]]
−
{{#set: centisome-position=21.60614    }}
+
* [[2PGADEHYDRAT-RXN]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[DAHPSYN-RXN]]
−
{{#set: nb reaction associated=3}}
+
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PEPPIth]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=phosphoenolpyruvate}}
 +
{{#set: inchi-key=inchikey=dtbnbxwjwcwcik-uhfffaoysa-k}}
 +
{{#set: molecular-weight=165.019}}

Latest revision as of 11:12, 18 March 2021

Metabolite PHOSPHO-ENOL-PYRUVATE

  • common-name:
    • phosphoenolpyruvate
  • smiles:
    • c=c(op([o-])([o-])=o)c([o-])=o
  • inchi-key:
    • dtbnbxwjwcwcik-uhfffaoysa-k
  • molecular-weight:
    • 165.019

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PHOSPHO-ENOL-PYRUVATE&oldid=137177"