Difference between revisions of "PHOSPHO-ENOL-PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TARTRONATE-S-ALD == * common-name: ** tartronate semialdehyde * smiles: ** [ch](=o)c(o)c(=o)[o-] * inchi-key: ** qwbafpfngrfsfb-uhfffaoys...")
(Created page with "Category:metabolite == Metabolite PHOSPHO-ENOL-PYRUVATE == * common-name: ** phosphoenolpyruvate * smiles: ** c=c(op([o-])([o-])=o)c([o-])=o * inchi-key: ** dtbnbxwjwcwcik...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite TARTRONATE-S-ALD ==
+
== Metabolite PHOSPHO-ENOL-PYRUVATE ==
 
* common-name:
 
* common-name:
−
** tartronate semialdehyde
+
** phosphoenolpyruvate
 
* smiles:
 
* smiles:
−
** [ch](=o)c(o)c(=o)[o-]
+
** c=c(op([o-])([o-])=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** qwbafpfngrfsfb-uhfffaoysa-m
+
** dtbnbxwjwcwcik-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
−
** 103.054
+
** 165.019
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-5289]]
+
* [[2.5.1.19-RXN]]
−
* [[TSA-REDUCT-RXN]]
+
* [[2PGADEHYDRAT-RXN]]
 +
* [[DAHPSYN-RXN]]
 +
* [[GTPOP]]
 +
* [[PEPCARBOX-RXN]]
 +
* [[PEPDEPHOS-RXN]]
 +
* [[PEPPIth]]
 +
* [[PPC]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
* [[RXN-14117]]
 +
* [[RXN-14192]]
 +
* [[RXN-14207]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN0-5289]]
+
* [[2.5.1.19-RXN]]
 +
* [[2PGADEHYDRAT-RXN]]
 +
* [[DAHPSYN-RXN]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PEPPIth]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=tartronate semialdehyde}}
+
{{#set: common-name=phosphoenolpyruvate}}
−
{{#set: inchi-key=inchikey=qwbafpfngrfsfb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=dtbnbxwjwcwcik-uhfffaoysa-k}}
−
{{#set: molecular-weight=103.054}}
+
{{#set: molecular-weight=165.019}}

Latest revision as of 11:12, 18 March 2021

Metabolite PHOSPHO-ENOL-PYRUVATE

  • common-name:
    • phosphoenolpyruvate
  • smiles:
    • c=c(op([o-])([o-])=o)c([o-])=o
  • inchi-key:
    • dtbnbxwjwcwcik-uhfffaoysa-k
  • molecular-weight:
    • 165.019

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PHOSPHO-ENOL-PYRUVATE&oldid=137177"