Difference between revisions of "PHOSPHO-ENOL-PYRUVATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19487 == * common-name: ** 3-isopropyl-10-(methylthio)-2-oxodecanoate * smiles: ** cscccccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite TARTRONATE-S-ALD == * common-name: ** tartronate semialdehyde * smiles: ** [ch](=o)c(o)c(=o)[o-] * inchi-key: ** qwbafpfngrfsfb-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TARTRONATE-S-ALD == |
* common-name: | * common-name: | ||
| − | ** | + | ** tartronate semialdehyde |
* smiles: | * smiles: | ||
| − | ** | + | ** [ch](=o)c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qwbafpfngrfsfb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 103.054 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[RXN0-5289]] |
| + | * [[TSA-REDUCT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-5289]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tartronate semialdehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qwbafpfngrfsfb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=103.054}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite TARTRONATE-S-ALD
- common-name:
- tartronate semialdehyde
- smiles:
- [ch](=o)c(o)c(=o)[o-]
- inchi-key:
- qwbafpfngrfsfb-uhfffaoysa-m
- molecular-weight:
- 103.054
