Difference between revisions of "PHOSPHORIBOSYL-AMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-380 == * common-name: ** 3-sulfopyruvate * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] * inchi-key: ** buthmsuebypmkj-uhfffaoysa-l * mo...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-AMP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-amp * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-380 ==
+
== Metabolite PHOSPHORIBOSYL-AMP ==
 
* common-name:
 
* common-name:
** 3-sulfopyruvate
+
** 1-(5-phospho-β-d-ribosyl)-amp
 
* smiles:
 
* smiles:
** c(=o)([o-])c(=o)cs(=o)(=o)[o-]
+
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** buthmsuebypmkj-uhfffaoysa-l
+
** rtqmrtsptliihm-keohhstqsa-j
 
* molecular-weight:
 
* molecular-weight:
** 166.105
+
** 555.288
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R230-RXN]]
+
* [[HISTCYCLOHYD-RXN]]
* [[RXN-11737]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R230-RXN]]
+
* [[HISTPRATPHYD-RXN]]
* [[RXN-11737]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-sulfopyruvate}}
+
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-amp}}
{{#set: inchi-key=inchikey=buthmsuebypmkj-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=rtqmrtsptliihm-keohhstqsa-j}}
{{#set: molecular-weight=166.105}}
+
{{#set: molecular-weight=555.288}}

Latest revision as of 11:16, 18 March 2021

Metabolite PHOSPHORIBOSYL-AMP

  • common-name:
    • 1-(5-phospho-β-d-ribosyl)-amp
  • smiles:
    • c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
  • inchi-key:
    • rtqmrtsptliihm-keohhstqsa-j
  • molecular-weight:
    • 555.288

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality