Difference between revisions of "PHOSPHORIBOSYL-AMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CORTISONE == * common-name: ** cortisone * smiles: ** cc34([ch]2(c(=o)cc1(c)([ch](ccc(c(=o)co)(o)1)[ch]2ccc3=cc(=o)cc4))) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-AMP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-amp * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHOSPHORIBOSYL-AMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-(5-phospho-β-d-ribosyl)-amp |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rtqmrtsptliihm-keohhstqsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 555.288 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[HISTCYCLOHYD-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[HISTPRATPHYD-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-(5-phospho-β-d-ribosyl)-amp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rtqmrtsptliihm-keohhstqsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=555.288}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite PHOSPHORIBOSYL-AMP
- common-name:
- 1-(5-phospho-β-d-ribosyl)-amp
- smiles:
- c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
- inchi-key:
- rtqmrtsptliihm-keohhstqsa-j
- molecular-weight:
- 555.288
