Difference between revisions of "PHOSPHORIBOSYL-AMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERTRANSAMPYR-RXN PSERTRANSAMPYR-RXN] == * direction: ** reversible * ec-number: ** [http://enzyme...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-AMP == * common-name: ** 1-(5-phospho-β-d-ribosyl)-amp * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERTRANSAMPYR-RXN PSERTRANSAMPYR-RXN] ==
+
== Metabolite PHOSPHORIBOSYL-AMP ==
* direction:
+
* common-name:
** reversible
+
** 1-(5-phospho-β-d-ribosyl)-amp
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.6.1.52 ec-2.6.1.52]
+
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
== Reaction formula ==
+
* inchi-key:
* 1 [[3OH-4P-OH-ALPHA-KETOBUTYRATE]][c] '''+''' 1 [[GLT]][c] '''<=>''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[4-PHOSPHONOOXY-THREONINE]][c]
+
** rtqmrtsptliihm-keohhstqsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ02143]]
+
** 555.288
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[HISTCYCLOHYD-RXN]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PYRIDOXSYN-PWY]], pyridoxal 5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXSYN-PWY PYRIDOXSYN-PWY]
+
* [[HISTPRATPHYD-RXN]]
** '''3''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=1-(5-phospho-&beta;-d-ribosyl)-amp}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=rtqmrtsptliihm-keohhstqsa-j}}
== External links  ==
+
{{#set: molecular-weight=555.288}}
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16576 16576]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R05085 R05085]
 
{{#set: direction=reversible}}
 
{{#set: ec-number=ec-2.6.1.52}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite PHOSPHORIBOSYL-AMP

  • common-name:
    • 1-(5-phospho-β-d-ribosyl)-amp
  • smiles:
    • c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop([o-])(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
  • inchi-key:
    • rtqmrtsptliihm-keohhstqsa-j
  • molecular-weight:
    • 555.288

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality