Difference between revisions of "PHOSPHORIBOSYL-AMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8083 == * common-name: ** 1-18:2-2-18:3-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c...")
(Created page with "Category:metabolite == Metabolite FE+3 == * common-name: ** fe3+ * smiles: ** [fe+++] * inchi-key: ** vtlyfuhaoxggbs-uhfffaoysa-n * molecular-weight: ** 55.847 == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8083 ==
+
== Metabolite FE+3 ==
 
* common-name:
 
* common-name:
** 1-18:2-2-18:3-digalactosyldiacylglycerol
+
** fe3+
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=ccc=ccc)=o
+
** [fe+++]
 
* inchi-key:
 
* inchi-key:
** gkshydzifvnlss-ipdwfasdsa-n
+
** vtlyfuhaoxggbs-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 939.231
+
** 55.847
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8314]]
+
* [[3.6.3.30-RXN]]
 +
* [[ExchangeSeed-FE+3]]
 +
* [[FE3abch]]
 +
* [[FESO3OXI-RXN]]
 +
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
 +
* [[RXN-14387]]
 +
* [[RXN-15598]]
 +
* [[TransportSeed-FE+3]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8313]]
+
* [[3.6.3.30-RXN]]
 +
* [[ExchangeSeed-FE+3]]
 +
* [[FE3abch]]
 +
* [[FESO3OXI-RXN]]
 +
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
 +
* [[RXN0-1483]]
 +
* [[TransportSeed-FE+3]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-18:3-digalactosyldiacylglycerol}}
+
{{#set: common-name=fe3+}}
{{#set: inchi-key=inchikey=gkshydzifvnlss-ipdwfasdsa-n}}
+
{{#set: inchi-key=inchikey=vtlyfuhaoxggbs-uhfffaoysa-n}}
{{#set: molecular-weight=939.231}}
+
{{#set: molecular-weight=55.847}}

Revision as of 14:58, 5 January 2021

Metabolite FE+3

  • common-name:
    • fe3+
  • smiles:
    • [fe+++]
  • inchi-key:
    • vtlyfuhaoxggbs-uhfffaoysa-n
  • molecular-weight:
    • 55.847

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality