|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8647 RXN-8647] == | + | == Metabolite PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** (6e,8z,11z,14z)-(5s)-5-hydroperoxyicosa-6,8,11,14-tetraenoate dehydratase | + | ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate |
| − | ** arachidonate 5-lipoxygenase
| + | * smiles: |
| − | == Reaction formula ==
| + | ** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2) |
| − | * 1 [[6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6]][c] '''=>''' 1 [[CPD-8892]][c] '''+''' 1 [[WATER]][c]
| + | * inchi-key: |
| − | == Gene(s) associated with this reaction ==
| + | ** xfvulmdjzxymsg-ziyngmlesa-k |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * molecular-weight: |
| − | * Gene: [[SJ16634]] | + | ** 336.174 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[AIRCARBOXY-RXN]] |
| − | * Gene: [[SJ21859]]
| + | * [[SAICARSYN-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[AIRCARBOXY-RXN]] |
| − | * Gene: [[SJ05858]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}} |
| − | * Gene: [[SJ16632]]
| + | {{#set: molecular-weight=336.174}} |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ12567]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ21862]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ08276]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ08291]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ05859]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ03316]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ16633]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY66-375]], leukotriene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-375 PWY66-375] | |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links ==
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17962 17962]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03058 R03058]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=arachidonate 5-lipoxygenase|(6e,8z,11z,14z)-(5s)-5-hydroperoxyicosa-6,8,11,14-tetraenoate dehydratase}} | |
| − | {{#set: nb gene associated=11}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
