Difference between revisions of "PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10775 == * transcription-direction: ** positive * right-end-position: ** 8481 * left-end-position: ** 7612 * centisome-position: ** 1.9788235 =...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE == * common-name: ** 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide * smiles: ** c(op([...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10775 ==
+
== Metabolite PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide
−
* right-end-position:
+
* smiles:
−
** 8481
+
** c(op([o-])(=o)[o-])c2(c(o)c(o)c(n1(c=nc(c(=o)n)=c(nc=o)1))o2)
−
* left-end-position:
+
* inchi-key:
−
** 7612
+
** abcooorlyaoboz-kqynxxcusa-l
−
* centisome-position:
+
* molecular-weight:
−
** 1.9788235   
+
** 364.208
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[AICARTRANSFORM-RXN]]
−
== Reaction(s) associated ==
+
* [[FPAIF]]
−
* [[3.1.26.4-RXN]]
+
* [[IMPCYCLOHYDROLASE-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[AICARTRANSFORM-RXN]]
−
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[FPAIF]]
−
** Category: [[annotation]]
+
* [[IMPCYCLOHYDROLASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
{{#set: common-name=5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=abcooorlyaoboz-kqynxxcusa-l}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=364.208}}
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=8481}}
 
−
{{#set: left-end-position=7612}}
 
−
{{#set: centisome-position=1.9788235    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 

Latest revision as of 11:10, 18 March 2021

Metabolite PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE

  • common-name:
    • 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide
  • smiles:
    • c(op([o-])(=o)[o-])c2(c(o)c(o)c(n1(c=nc(c(=o)n)=c(nc=o)1))o2)
  • inchi-key:
    • abcooorlyaoboz-kqynxxcusa-l
  • molecular-weight:
    • 364.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE&oldid=136611"