Difference between revisions of "PHOSPHORIBULOSYL-FORMIMINO-AICAR-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OLEATE-CPD ==
+
== Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P ==
 
* common-name:
 
* common-name:
** oleate
+
** phosphoribulosylformimino-aicar-phosphate
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc([o-])=o
+
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
 
* inchi-key:
 
* inchi-key:
** zqppmhvwecsirj-ktkrtigzsa-m
+
** blkfnhochnclii-ghvqhmavsa-j
 
* molecular-weight:
 
* molecular-weight:
** 281.457
+
** 573.303
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FACOAL18111Z]]
+
* [[GLUTAMIDOTRANS-RXN]]
* [[RXN-10756]]
+
* [[RXN-17900]]
* [[RXN-9644]]
 
* [[RXN0-7239]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FACOAE18111Z]]
+
* [[PRIBFAICARPISOM-RXN]]
* [[RXN-10756]]
+
* [[PRICI]]
* [[RXN-15035]]
 
* [[RXN-15067]]
 
* [[RXN-15068]]
 
* [[RXN-15088]]
 
* [[RXN-15089]]
 
* [[RXN-15133]]
 
* [[RXN-15135]]
 
* [[RXN-9666]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oleate}}
+
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
+
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
{{#set: molecular-weight=281.457}}
+
{{#set: molecular-weight=573.303}}

Revision as of 11:18, 15 January 2021

Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P

  • common-name:
    • phosphoribulosylformimino-aicar-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
  • inchi-key:
    • blkfnhochnclii-ghvqhmavsa-j
  • molecular-weight:
    • 573.303

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality