Difference between revisions of "PHOSPHORIBULOSYL-FORMIMINO-AICAR-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13805 RXN-13805] == * direction: ** reversible * common-name: ** sn-1-glycerol-3-phosphate c16:...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13805 RXN-13805] ==
+
== Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** sn-1-glycerol-3-phosphate c16:0-dca-coa acyl transferase
+
** phosphoribulosylformimino-aicar-phosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.3.1.15 ec-2.3.1.15]
+
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-14772]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-14828]][c]
+
** blkfnhochnclii-ghvqhmavsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ18504]]
+
** 573.303
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GLUTAMIDOTRANS-RXN]]
* Gene: [[SJ11668]]
+
* [[RXN-17900]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PRIBFAICARPISOM-RXN]]
** Category: [[orthology]]
+
* [[PRICI]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=573.303}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
{{#set: direction=reversible}}
 
{{#set: common-name=sn-1-glycerol-3-phosphate c16:0-dca-coa acyl transferase}}
 
{{#set: ec-number=ec-2.3.1.15}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P

  • common-name:
    • phosphoribulosylformimino-aicar-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
  • inchi-key:
    • blkfnhochnclii-ghvqhmavsa-j
  • molecular-weight:
    • 573.303

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality