Difference between revisions of "PHOSPHORIBULOSYL-FORMIMINO-AICAR-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10277 == * common-name: ** lotaustralin * smiles: ** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c * inchi-key: ** wewbwvmtoyuphh-qhaqebjbsa-n...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10277 ==
+
== Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P ==
 
* common-name:
 
* common-name:
** lotaustralin
+
** phosphoribulosylformimino-aicar-phosphate
 
* smiles:
 
* smiles:
** ccc(oc1(oc(co)c(o)c(o)c(o)1))(c#n)c
+
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
 
* inchi-key:
 
* inchi-key:
** wewbwvmtoyuphh-qhaqebjbsa-n
+
** blkfnhochnclii-ghvqhmavsa-j
 
* molecular-weight:
 
* molecular-weight:
** 261.274
+
** 573.303
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9674]]
+
* [[GLUTAMIDOTRANS-RXN]]
 +
* [[RXN-17900]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13603]]
+
* [[PRIBFAICARPISOM-RXN]]
 +
* [[PRICI]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lotaustralin}}
+
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
{{#set: inchi-key=inchikey=wewbwvmtoyuphh-qhaqebjbsa-n}}
+
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
{{#set: molecular-weight=261.274}}
+
{{#set: molecular-weight=573.303}}

Latest revision as of 11:16, 18 March 2021

Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P

  • common-name:
    • phosphoribulosylformimino-aicar-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
  • inchi-key:
    • blkfnhochnclii-ghvqhmavsa-j
  • molecular-weight:
    • 573.303

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality