Difference between revisions of "PHOSPHORIBULOSYL-FORMIMINO-AICAR-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-488 == * common-name: ** β-l-fucose 1-phosphate * smiles: ** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** ptvxqarclqpg...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** phosphoribulosylformimino-aicar-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** blkfnhochnclii-ghvqhmavsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 573.303 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLUTAMIDOTRANS-RXN]] | ||
| + | * [[RXN-17900]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PRIBFAICARPISOM-RXN]] |
| + | * [[PRICI]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phosphoribulosylformimino-aicar-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=573.303}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P
- common-name:
- phosphoribulosylformimino-aicar-phosphate
- smiles:
- c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
- inchi-key:
- blkfnhochnclii-ghvqhmavsa-j
- molecular-weight:
- 573.303
