Difference between revisions of "PHOSPHORIBULOSYL-FORMIMINO-AICAR-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-488 == * common-name: ** β-l-fucose 1-phosphate * smiles: ** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** ptvxqarclqpg...")
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-488 ==
+
== Metabolite OLEATE-CPD ==
 
* common-name:
 
* common-name:
−
** β-l-fucose 1-phosphate
+
** oleate
 
* smiles:
 
* smiles:
−
** cc1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
+
** ccccccccc=ccccccccc([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** ptvxqarclqpgir-sxuwkvjysa-l
+
** zqppmhvwecsirj-ktkrtigzsa-m
 
* molecular-weight:
 
* molecular-weight:
−
** 242.122
+
** 281.457
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[FACOAL18111Z]]
 +
* [[RXN-10756]]
 +
* [[RXN-9644]]
 +
* [[RXN0-7239]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[FUCOKINASE-RXN]]
+
* [[FACOAE18111Z]]
 +
* [[RXN-10756]]
 +
* [[RXN-15035]]
 +
* [[RXN-15067]]
 +
* [[RXN-15068]]
 +
* [[RXN-15088]]
 +
* [[RXN-15089]]
 +
* [[RXN-15133]]
 +
* [[RXN-15135]]
 +
* [[RXN-9666]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=β-l-fucose 1-phosphate}}
+
{{#set: common-name=oleate}}
−
{{#set: inchi-key=inchikey=ptvxqarclqpgir-sxuwkvjysa-l}}
+
{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
−
{{#set: molecular-weight=242.122}}
+
{{#set: molecular-weight=281.457}}

Revision as of 18:57, 14 January 2021

Metabolite OLEATE-CPD

  • common-name:
    • oleate
  • smiles:
    • ccccccccc=ccccccccc([o-])=o
  • inchi-key:
    • zqppmhvwecsirj-ktkrtigzsa-m
  • molecular-weight:
    • 281.457

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PHOSPHORIBULOSYL-FORMIMINO-AICAR-P&oldid=99990"