Difference between revisions of "PHOSPHORIBULOSYL-FORMIMINO-AICAR-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16292 RXN-16292] == * direction: ** left-to-right * common-name: ** dapdiamide b synthase * ec-...")
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16292 RXN-16292] ==
+
== Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** dapdiamide b synthase
+
** phosphoribulosylformimino-aicar-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.3.2.47 ec-6.3.2.47]
+
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CPD-18312]][c] '''+''' 1 [[ILE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CPD-17540]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
+
** blkfnhochnclii-ghvqhmavsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11003]]
+
** 573.303
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GLUTAMIDOTRANS-RXN]]
−
* Gene: [[SJ05967]]
+
* [[RXN-17900]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PRIBFAICARPISOM-RXN]]
−
== Pathway(s) ==
+
* [[PRICI]]
−
* [[PWY-7706]], dapdiamides biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7706 PWY-7706]
+
== Reaction(s) of unknown directionality ==
−
** '''4''' reactions found over '''13''' reactions in the full pathway
+
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=573.303}}
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=dapdiamide b synthase}}
 
−
{{#set: ec-number=ec-6.3.2.47}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P

  • common-name:
    • phosphoribulosylformimino-aicar-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
  • inchi-key:
    • blkfnhochnclii-ghvqhmavsa-j
  • molecular-weight:
    • 573.303

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PHOSPHORIBULOSYL-FORMIMINO-AICAR-P&oldid=139062"