Difference between revisions of "PHOSPHORYL-CHOLINE"

Latest revision as of 11:17, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15366 ==
+== Metabolite PHOSPHORYL-CHOLINE ==
 * common-name:
-** lesqueroloyl-coa
+** phosphocholine
 * smiles:
-** ccccccc(o)cc=ccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c[n+](ccop([o-])([o-])=o)(c)c
 * inchi-key:
-** jjyivzkvzzsdmc-gxvfdtdksa-j
+** yhhsonzfoiemcp-uhfffaoysa-m
 * molecular-weight:
-** 1072.006
+** 182.136
 == Reaction(s) known to consume the compound ==
-* [[RXN-16152]]
+* [[2.7.7.15-RXN]]
+* [[CHLPCTDh]]
+* [[RXN-5647]]
+* [[RXN-9614]]
 == Reaction(s) known to produce the compound ==
+* [[CHOLINE-KINASE-RXN]]
+* [[PHOSPHOLIPASE-C-RXN]]
+* [[RXN-15212]]
+* [[RXN-9614]]
+* [[SPHINGOMYELIN-PHOSPHODIESTERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=lesqueroloyl-coa}}
+{{#set: common-name=phosphocholine}}
-{{#set: inchi-key=inchikey=jjyivzkvzzsdmc-gxvfdtdksa-j}}
+{{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}}
-{{#set: molecular-weight=1072.006}}
+{{#set: molecular-weight=182.136}}