Difference between revisions of "PHOSPHORYL-CHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SUPER-OXIDE == * common-name: ** superoxide * smiles: ** [o-]o * inchi-key: ** ouuqczgpvncoij-uhfffaoysa-m * molecular-weight: ** 31.999...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * smiles: ** c[n+](ccop([o-])([o-])=o)(c)c * inchi-key: ** yhhsonzfoiemcp-uhfffaoy...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHOSPHORYL-CHOLINE == |
* common-name: | * common-name: | ||
− | ** | + | ** phosphocholine |
* smiles: | * smiles: | ||
− | ** [o-]o | + | ** c[n+](ccop([o-])([o-])=o)(c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yhhsonzfoiemcp-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 182.136 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.7.15-RXN]] |
+ | * [[CHLPCTDh]] | ||
+ | * [[RXN-5647]] | ||
+ | * [[RXN-9614]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[CHOLINE-KINASE-RXN]] |
+ | * [[PHOSPHOLIPASE-C-RXN]] | ||
+ | * [[RXN-15212]] | ||
+ | * [[RXN-9614]] | ||
+ | * [[SPHINGOMYELIN-PHOSPHODIESTERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=phosphocholine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=182.136}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite PHOSPHORYL-CHOLINE
- common-name:
- phosphocholine
- smiles:
- c[n+](ccop([o-])([o-])=o)(c)c
- inchi-key:
- yhhsonzfoiemcp-uhfffaoysa-m
- molecular-weight:
- 182.136