Difference between revisions of "PHOSPHORYL-ETHANOLAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PAPS == * common-name: ** 3'-phosphoadenylyl-sulfate * smiles: ** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(...")
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-ETHANOLAMINE == * common-name: ** o-phosphoethanolamine * smiles: ** c(c[n+])op([o-])([o-])=o * inchi-key: ** suhootkupisobe-u...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PAPS ==
+
== Metabolite PHOSPHORYL-ETHANOLAMINE ==
 
* common-name:
 
* common-name:
** 3'-phosphoadenylyl-sulfate
+
** o-phosphoethanolamine
 
* smiles:
 
* smiles:
** c(op(=o)([o-])os(=o)(=o)[o-])c1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23)))
+
** c(c[n+])op([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
** gacdqmdrprgctn-kqynxxcusa-j
+
** suhootkupisobe-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 503.23
+
** 140.055
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[2.7.7.14-RXN]]
* [[1.8.4.8-RXN]]
+
* [[RXN-7948]]
* [[2.8.2.23-RXN]]
 
* [[2.8.2.29-RXN]]
 
* [[2.8.2.30-RXN]]
 
* [[ADENYLYLSULFKIN-RXN]]
 
* [[ARYL-SULFOTRANSFERASE-RXN]]
 
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
 
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
 
* [[PAPSPAPthr]]
 
* [[R163-RXN]]
 
* [[RXN-10614]]
 
* [[RXN-10615]]
 
* [[RXN-10777]]
 
* [[RXN-10782]]
 
* [[RXN-11058]]
 
* [[RXN-11059]]
 
* [[RXN-11555]]
 
* [[RXN-15587]]
 
* [[RXN-15588]]
 
* [[RXN-15589]]
 
* [[RXN-17203]]
 
* [[RXN-18301]]
 
* [[RXN-18303]]
 
* [[RXN-701]]
 
* [[RXN-7953]]
 
* [[RXN-7954]]
 
* [[RXN6666-9]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.8.4.8-RXN]]
+
* [[ETHANOLAMINE-KINASE-RXN]]
* [[ADENYLYLSULFKIN-RXN]]
+
* [[RXN-13729]]
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
+
* [[RXN3DJ-11230]]
* [[PAPSPAPthr]]
+
* [[SGPL11]]
* [[R163-RXN]]
+
* [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]]
* [[RXN-15587]]
 
* [[RXN-15588]]
 
* [[RXN-15589]]
 
* [[RXN-17203]]
 
* [[RXN-701]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3'-phosphoadenylyl-sulfate}}
+
{{#set: common-name=o-phosphoethanolamine}}
{{#set: inchi-key=inchikey=gacdqmdrprgctn-kqynxxcusa-j}}
+
{{#set: inchi-key=inchikey=suhootkupisobe-uhfffaoysa-m}}
{{#set: molecular-weight=503.23}}
+
{{#set: molecular-weight=140.055}}

Latest revision as of 11:17, 18 March 2021

Metabolite PHOSPHORYL-ETHANOLAMINE

  • common-name:
    • o-phosphoethanolamine
  • smiles:
    • c(c[n+])op([o-])([o-])=o
  • inchi-key:
    • suhootkupisobe-uhfffaoysa-m
  • molecular-weight:
    • 140.055

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality