Difference between revisions of "PHTYOSPHINGOSINE-1-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cytidine-34-tRNAs == * common-name: ** a cytidine34 in trna == Reaction(s) known to consume the compound == * RXN-11860 == Reaction(s...")
(Created page with "Category:metabolite == Metabolite CPD-10254 == * common-name: ** (9z,12z)-hexadeca-9,12-dienoyl-coa * smiles: ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cytidine-34-tRNAs ==
+
== Metabolite CPD-10254 ==
 
* common-name:
 
* common-name:
** a cytidine34 in trna
+
** (9z,12z)-hexadeca-9,12-dienoyl-coa
 +
* smiles:
 +
** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** cqxsjfxwargobe-pcrjdaltsa-j
 +
* molecular-weight:
 +
** 997.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11860]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9616]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cytidine34 in trna}}
+
{{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}}
 +
{{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}}
 +
{{#set: molecular-weight=997.883}}

Revision as of 08:25, 15 March 2021

Metabolite CPD-10254

  • common-name:
    • (9z,12z)-hexadeca-9,12-dienoyl-coa
  • smiles:
    • cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • cqxsjfxwargobe-pcrjdaltsa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality