Difference between revisions of "PHTYOSPHINGOSINE-1-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite mRNA-Adenines == * common-name: ** an adenine in mrna == Reaction(s) known to consume the compound == * RXN-17811 == Reaction(s) know...")
(Created page with "Category:metabolite == Metabolite PHYTOL == * common-name: ** phytol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cco * inchi-key: ** botwfxyspfmfnr-pyddkjgssa-n * molecular-we...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite mRNA-Adenines ==
+
== Metabolite PHYTOL ==
 
* common-name:
 
* common-name:
** an adenine in mrna
+
** phytol
 +
* smiles:
 +
** cc(c)cccc(c)cccc(c)cccc(c)=cco
 +
* inchi-key:
 +
** botwfxyspfmfnr-pyddkjgssa-n
 +
* molecular-weight:
 +
** 296.535
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17811]]
+
* [[RXN-7683]]
 +
* [[RXN66-478]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17811]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an adenine in mrna}}
+
{{#set: common-name=phytol}}
 +
{{#set: inchi-key=inchikey=botwfxyspfmfnr-pyddkjgssa-n}}
 +
{{#set: molecular-weight=296.535}}

Revision as of 13:08, 14 January 2021

Metabolite PHYTOL

  • common-name:
    • phytol
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=cco
  • inchi-key:
    • botwfxyspfmfnr-pyddkjgssa-n
  • molecular-weight:
    • 296.535

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality