Difference between revisions of "PHYTOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCYLGLYCINE == * common-name: ** glycyl-glycine * smiles: ** c([n+])c(=o)ncc([o-])=o * inchi-key: ** ymawopbaydpsla-uhfffaoysa-n * mole...") |
(Created page with "Category:metabolite == Metabolite PHYTOL == * common-name: ** phytol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cco * inchi-key: ** botwfxyspfmfnr-pyddkjgssa-n * molecular-we...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHYTOL == |
* common-name: | * common-name: | ||
− | ** | + | ** phytol |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c)cccc(c)cccc(c)cccc(c)=cco |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** botwfxyspfmfnr-pyddkjgssa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 296.535 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7683]] |
+ | * [[RXN66-478]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=phytol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=botwfxyspfmfnr-pyddkjgssa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=296.535}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite PHYTOL
- common-name:
- phytol
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=cco
- inchi-key:
- botwfxyspfmfnr-pyddkjgssa-n
- molecular-weight:
- 296.535