Difference between revisions of "PHYTYL-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17312 == * common-name: ** docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite Dodec-2-enoyl-ACPs == * common-name: ** a (2e)-dodec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9534 * RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17312 ==
+
== Metabolite Dodec-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** docosahexaenoyl-coa
+
** a (2e)-dodec-2-enoyl-[acp]
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** menfzxmqsyyvrk-crcgjgbysa-j
 
* molecular-weight:
 
** 1073.981
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16063]]
+
* [[RXN-9534]]
 +
* [[RXN-9661]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16063]]
+
* [[RXN-9533]]
* [[RXN-16137]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=docosahexaenoyl-coa}}
+
{{#set: common-name=a (2e)-dodec-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=menfzxmqsyyvrk-crcgjgbysa-j}}
 
{{#set: molecular-weight=1073.981}}
 

Revision as of 08:31, 15 March 2021

Metabolite Dodec-2-enoyl-ACPs

  • common-name:
    • a (2e)-dodec-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (2e)-dodec-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.