Difference between revisions of "PHYTYL-PYROPHOSPHATE"

Latest revision as of 11:17, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-17312 ==
+== Metabolite PHYTYL-PYROPHOSPHATE ==
 * common-name:
-** docosahexaenoyl-coa
+** phytyl diphosphate
 * smiles:
-** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 * inchi-key:
-** menfzxmqsyyvrk-crcgjgbysa-j
+** itplbnccpzsweu-pyddkjgssa-k
 * molecular-weight:
-** 1073.981
+** 453.471
 == Reaction(s) known to consume the compound ==
-* [[RXN-16063]]
+* [[RXN-2541]]
+* [[RXN-7660]]
+* [[RXN-7674]]
+* [[RXN1F-66]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16063]]
+* [[RXN-10625]]
-* [[RXN-16137]]
+* [[RXN-7660]]
+* [[RXN1F-66]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=docosahexaenoyl-coa}}
+{{#set: common-name=phytyl diphosphate}}
-{{#set: inchi-key=inchikey=menfzxmqsyyvrk-crcgjgbysa-j}}
+{{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}}
-{{#set: molecular-weight=1073.981}}
+{{#set: molecular-weight=453.471}}