Difference between revisions of "PHYTYL-PYROPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIOHBUTANONEPSYN-RXN DIOHBUTANONEPSYN-RXN] == * direction: ** left-to-right * common-name: ** 3,4-d...")
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIOHBUTANONEPSYN-RXN DIOHBUTANONEPSYN-RXN] ==
+
== Metabolite PHYTYL-PYROPHOSPHATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3,4-dihydroxy-2-butanone-4-phosphate synthase
+
** phytyl diphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.99.12 ec-4.1.99.12]
+
** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[RIBULOSE-5P]][c] '''=>''' 1 [[DIHYDROXY-BUTANONE-P]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[PROTON]][c]
+
** itplbnccpzsweu-pyddkjgssa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17329]]
+
** 453.471
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-2541]]
−
== Pathway(s) ==
+
* [[RXN-7660]]
−
* [[RIBOSYN2-PWY]], flavin biosynthesis I (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY]
+
* [[RXN-7674]]
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN1F-66]]
−
* [[PWY-6167]], flavin biosynthesis II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6167 PWY-6167]
+
== Reaction(s) known to produce the compound ==
−
** '''5''' reactions found over '''10''' reactions in the full pathway
+
* [[RXN-10625]]
−
* [[PWY-6168]], flavin biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6168 PWY-6168]
+
* [[RXN-7660]]
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN1F-66]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=phytyl diphosphate}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}}
−
* RHEA:
+
{{#set: molecular-weight=453.471}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18458 18458]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07281 R07281]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3,4-dihydroxy-2-butanone-4-phosphate synthase}}
 
−
{{#set: ec-number=ec-4.1.99.12}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite PHYTYL-PYROPHOSPHATE

  • common-name:
    • phytyl diphosphate
  • smiles:
    • cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
  • inchi-key:
    • itplbnccpzsweu-pyddkjgssa-k
  • molecular-weight:
    • 453.471

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PHYTYL-PYROPHOSPHATE&oldid=139526"