Difference between revisions of "PHYTYL-PYROPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LEUKOTRIENE-C4 == * common-name: ** leukotriene-c4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc(...") |
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHYTYL-PYROPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** phytyl diphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** itplbnccpzsweu-pyddkjgssa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 453.471 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-2541]] |
| + | * [[RXN-7660]] | ||
| + | * [[RXN-7674]] | ||
| + | * [[RXN1F-66]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10625]] |
| + | * [[RXN-7660]] | ||
| + | * [[RXN1F-66]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phytyl diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=453.471}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite PHYTYL-PYROPHOSPHATE
- common-name:
- phytyl diphosphate
- smiles:
- cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
- inchi-key:
- itplbnccpzsweu-pyddkjgssa-k
- molecular-weight:
- 453.471
