|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-KIN-RXN GLYCEROL-KIN-RXN] == | + | == Metabolite PHYTYL-PYROPHOSPHATE == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** glycerol kinase | + | ** phytyl diphosphate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.1.30 ec-2.7.1.30] | + | ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[GLYCEROL]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''+''' 1 [[PROTON]][c]
| + | ** itplbnccpzsweu-pyddkjgssa-k |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ11594]] | + | ** 453.471 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-2541]] |
| − | ** Category: [[orthology]]
| + | * [[RXN-7660]] |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-7674]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN1F-66]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ11595]]
| + | * [[RXN-10625]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-7660]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN1F-66]] |
| − | == Pathway(s) == | + | == Reaction(s) of unknown directionality == |
| − | * [[PWY-4261]], glycerol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4261 PWY-4261] | + | {{#set: common-name=phytyl diphosphate}} |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway | + | {{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}} |
| − | == Reconstruction information ==
| + | {{#set: molecular-weight=453.471}} |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA: | |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21647 21647]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00847 R00847]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P18157 P18157]
| |
| − | ** [http://www.uniprot.org/uniprot/P47284 P47284]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CG64 Q9CG64]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9V207 Q9V207]
| |
| − | ** [http://www.uniprot.org/uniprot/P44400 P44400]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9WX53 Q9WX53]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M0X5 Q7M0X5]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A6F3 P0A6F3]
| |
| − | ** [http://www.uniprot.org/uniprot/P25013 P25013]
| |
| − | ** [http://www.uniprot.org/uniprot/P19255 P19255]
| |
| − | ** [http://www.uniprot.org/uniprot/P32190 P32190]
| |
| − | ** [http://www.uniprot.org/uniprot/P32189 P32189]
| |
| − | ** [http://www.uniprot.org/uniprot/P95907 P95907]
| |
| − | ** [http://www.uniprot.org/uniprot/Q49011 Q49011]
| |
| − | ** [http://www.uniprot.org/uniprot/O93623 O93623]
| |
| − | </div>
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=glycerol kinase}} | |
| − | {{#set: ec-number=ec-2.7.1.30}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_nannochloropsis_salina|output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
