Difference between revisions of "PHYTYL-PYROPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12378 RXN-12378] == * direction: ** left-to-right * common-name: ** trna (guanine26-n2-methyltr...") |
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PHYTYL-PYROPHOSPHATE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** phytyl diphosphate |
| − | * | + | * smiles: |
| − | ** [ | + | ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c |
| − | = | + | * inchi-key: |
| − | + | ** itplbnccpzsweu-pyddkjgssa-k | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 453.471 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-2541]] |
| − | + | * [[RXN-7660]] | |
| − | * | + | * [[RXN-7674]] |
| − | + | * [[RXN1F-66]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10625]] | |
| − | * | + | * [[RXN-7660]] |
| − | == | + | * [[RXN1F-66]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: common-name= | + | {{#set: common-name=phytyl diphosphate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=itplbnccpzsweu-pyddkjgssa-k}} |
| − | {{#set: | + | {{#set: molecular-weight=453.471}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite PHYTYL-PYROPHOSPHATE
- common-name:
- phytyl diphosphate
- smiles:
- cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
- inchi-key:
- itplbnccpzsweu-pyddkjgssa-k
- molecular-weight:
- 453.471
