Difference between revisions of "PLASMENYLCHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite PLASMENYLCHOLINE == * common-name: ** a plasmenylcholine == Reaction(s) known to consume the compound == * PLASMALOGEN-SYNTHASE-RXN *...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-GLUTAMATE-5-P ==
+
== Metabolite PLASMENYLCHOLINE ==
 
* common-name:
 
* common-name:
** γ-l-glutamyl 5-phosphate
+
** a plasmenylcholine
* smiles:
 
** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
 
* inchi-key:
 
** pjrxvijaernuip-vkhmyheasa-l
 
* molecular-weight:
 
** 225.094
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[G5DH]]
+
* [[PLASMALOGEN-SYNTHASE-RXN]]
* [[G5DHm]]
+
* [[RXN-17736]]
* [[GLUTSEMIALDEHYDROG-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTKIN-RXN]]
+
* [[PLASMALOGEN-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-l-glutamyl 5-phosphate}}
+
{{#set: common-name=a plasmenylcholine}}
{{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}}
 
{{#set: molecular-weight=225.094}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite PLASMENYLCHOLINE

  • common-name:
    • a plasmenylcholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality