Difference between revisions of "PLASMENYLCHOLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11671 == * common-name: ** 5-hydroxytryptophol * smiles: ** c(o)cc1(=cnc2(=c1c=c(o)c=c2)) * inchi-key: ** kqrohcsyogbqgj-uhfffaoysa-n...") |
(Created page with "Category:metabolite == Metabolite PLASMENYLCHOLINE == * common-name: ** a plasmenylcholine == Reaction(s) known to consume the compound == * PLASMALOGEN-SYNTHASE-RXN *...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PLASMENYLCHOLINE == |
* common-name: | * common-name: | ||
− | ** | + | ** a plasmenylcholine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[PLASMALOGEN-SYNTHASE-RXN]] |
− | * [[RXN- | + | * [[RXN-17736]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[PLASMALOGEN-SYNTHASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a plasmenylcholine}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite PLASMENYLCHOLINE
- common-name:
- a plasmenylcholine